blumeatin manufacturers
- blumeatin
-
-
2026-07-10
- CAS:118024-26-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
- Blumeatin
-
- $56.00
-
2026-04-20
- CAS:118024-26-3
- Purity: 98.51%
- Supply Ability: 10g
|
| | blumeatin Basic information |
| Product Name: | blumeatin | | Synonyms: | blumeatin;5,3',5'-Trihydroxy-7-methoxyflavanone;(2S)-2-(3,5-Dihydroxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydro-4H-c hromen-4-one;5,3',5'-trihydroxymethoxylflavanone;4H-1-Benzopyran-4-one, 2-(3,5-dihydroxyphenyl)-2,3-dihydro-5-hydroxy-7-methoxy-, (2S)-;Bluemeatin;Inhibitor,Blumeatin,inhibit;(S)-2-(3,5-Dihydroxyphenyl)-5-hydroxy-7-methoxychroman-4-one | | CAS: | 118024-26-3 | | MF: | C16H14O6 | | MW: | 302.28 | | EINECS: | | | Product Categories: | | | Mol File: | 118024-26-3.mol |  |
| | blumeatin Chemical Properties |
| Melting point | 218-220 °C | | Boiling point | 603.3±55.0 °C(Predicted) | | density | 1.458±0.06 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 7.39±0.40(Predicted) | | color | White to off-white | | InChI | InChI=1S/C16H14O6/c1-21-11-5-12(19)16-13(20)7-14(22-15(16)6-11)8-2-9(17)4-10(18)3-8/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 | | InChIKey | YEYLMQKEGSQNGZ-AWEZNQCLSA-N | | SMILES | [C@H]1(C2=CC(O)=CC(O)=C2)OC2=CC(OC)=CC(O)=C2C(=O)C1 |
| | blumeatin Usage And Synthesis |
| Chemical Properties | Pale yellow crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, from Aina Xiang, Desert Ga. | | Uses | Flavonoids is the parent compound for L118920. Flavonoids are ant-idiabetic activity, most of the flavonoids showed a remarkable in vitro activity. | | Definition | ChEBI: Blumeatin is a member of flavonoids and an ether. | | target | GLUT |
| | blumeatin Preparation Products And Raw materials |
|