| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Thielavin B
CAS:71950-67-9
Purity:>=95% (LC/MS-UV) Package:1MG Remarks:SMB00566-1MG
|
|
| | thielavin B Basic information |
| Product Name: | thielavin B | | Synonyms: | thielavin B;4-[(2,4-Dihydroxy-3,6-dimethylbenzoyl)oxy]-2-methoxy-3,5,6-trimethylbenzoic acid 4-carboxy-3-methoxy-2,5,6-trimethylphenyl ester | | CAS: | 71950-67-9 | | MF: | | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 71950-67-9.mol |  |
| | thielavin B Chemical Properties |
| storage temp. | -20°C | | solubility | DMF: soluble; DMSO: soluble; Ethanol: soluble | | form | White to off-white powder. | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | UULGWGARYDGVBM-UHFFFAOYSA-N | | SMILES | O=C(C1=C(OC)C(C)=C(OC(C2=C(O)C(C)=C(O)C=C2C)=O)C(C)=C1C)OC3=C(C)C(C)=C(C(O)=O)C(OC)=C3C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | thielavin B Usage And Synthesis |
| Description | Thielavin B is a fungal metabolite that contains O-substituted salicylic acid. It inhibits cyclooxygenase, blocking both the conversion of arachidonic acid to Prostaglandin H2 (PGH2) and the conversion of PGH2 to PGE2 (, IC50s = 40 and 9 μM, respectively). Thielavin B also inhibits the reverse transcriptase of avian myeloblastosis virus, bacterial transglycosylases, and telomerase activity. | | Uses | Thielavin B is a fungal metabolite closely related to thielavin A but reported to have a slightly different biochemical profile. Thielavins inhibit glucose-6-phosphatase. Thielavin B is a potent inhibitor of phospholipase C, and inhibits peptidoglycan formation and prostaglandin biosynthesis. | | Uses | Thielavin B is a fungal metabolite of?Thielavia terricola that contains O-substituted salicylic acid. It is an inhibitor of viral reverse transcriptase and telomerase. | | General Description | Natural product derived from fungal source. | | References | [1] N MANI. Screening systems for detecting inhibitors of cell wall transglycosylation in Enterococcus. Cell wall transglycosylation inhibitors in Enterococcus.[J]. Journal of Antibiotics, 1998, 51 5: 471-479. DOI: 10.7164/antibiotics.51.471
[2] KEN-ICHI TOGASHI. Inhibition of Telomerase Activity by Fungus Metabolites, CRM646-A and Thielavin B[J]. Bioscience, Biotechnology, and Biochemistry, 2001, 65 1: 651-653. DOI: 10.1271/bbb.65.651 |
| | thielavin B Preparation Products And Raw materials |
|