| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | D-Fructose-1-13C Basic information |
| | D-Fructose-1-13C Chemical Properties |
| Melting point | 119-122 °C (dec.) (lit.) | | density | 1.589±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]20/D -93.5°, c = 2 in H2O (trace NH4OH) | | InChI | 1S/C6H12O6/c7-1-3-4(9)5(10)6(11,2-8)12-3/h3-5,7-11H,1-2H2/t3-,4-,5+,6/m1/s1/i2+1 | | InChIKey | RFSUNEUAIZKAJO-BORCATHGSA-N | | SMILES | OC[C@H]1OC(O)([13CH2]O)[C@@H](O)[C@@H]1O | | CAS Number Unlabeled | 57-48-7 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-Fructose-1-13C Usage And Synthesis |
| Uses | Isotope labelled D-Fructose (F792500), a monosaccharide that naturally occurs in large number of fruits and plants. |
| | D-Fructose-1-13C Preparation Products And Raw materials |
|