| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
4-Amino-1-naphthalenesulfonic acid sodium salt manufacturers
|
| | 4-Amino-1-naphthalenesulfonic acid sodium salt Basic information |
| Product Name: | 4-Amino-1-naphthalenesulfonic acid sodium salt | | Synonyms: | 1-Naphthylamine-4-sulfonic acid sodium salt, Naphthionic acid sodium salt, Sodium 4-amino-1-naphthalenesulfonate;4-Amino-1-naphthalenesulfonic acid hydrate sodium salt;4-Amino-1-naphthalenesulfonic acid sodium salt hydrate technical;SODIUM NAPTHIONATE;SODIUM NAPHTHIONATE;SODIUM NAPHTHIONATE HYDRATE;SODIUM 4-AMINO-1-NAPHTHALENESULFONATE HYDRATE;SODIUM 1-NAPHTHYLAMINE-4-SULFONATE | | CAS: | 123333-48-2 | | MF: | C10H8NNaO3S | | MW: | 245.23 | | EINECS: | 683-060-6 | | Product Categories: | | | Mol File: | 123333-48-2.mol |  |
| | 4-Amino-1-naphthalenesulfonic acid sodium salt Chemical Properties |
| Melting point | 280 °C (dec.)(lit.) | | form | crystals | | BRN | 3784871 | | InChI | 1S/C10H9NO3S.Na.H2O/c11-9-5-6-10(15(12,13)14)8-4-2-1-3-7(8)9;;/h1-6H,11H2,(H,12,13,14);;1H2/q;+1;/p-1 | | InChIKey | PGVZBSXAFZCRTM-UHFFFAOYSA-M | | SMILES | [Na+].[H]O[H].Nc1ccc(c2ccccc12)S([O-])(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 3-8-23 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Amino-1-naphthalenesulfonic acid sodium salt Usage And Synthesis |
| Uses | 4-Amino-1-naphthalenesulfonic acid sodium salt hydrate can be used:
- To prepare 1-bromo-4-naphthalenesulfonic acid, applicable as a phosphorophore in the detection of peptides by capillary electrophoresis.
- As a reactant to synthesize scandium complexes, applicable as artificial receptors in the removal of amphoteric αamino acids from aqueous solutions.
|
| | 4-Amino-1-naphthalenesulfonic acid sodium salt Preparation Products And Raw materials |
|