|
|
| | 2-Aminomethyl-4-Boc-morpholine Basic information |
| Product Name: | 2-Aminomethyl-4-Boc-morpholine | | Synonyms: | TERTIO-BUTYL 2-(AMINOMETHYL)MORPHOLINE-4-CARBOXYLATE;2-(AMINOMETHYL)MORPHOLINE, 4-BOC PROTECTED;2-Aminomethyl-morpholine-4-carboxylic acid tert-butyl ester;N-Boc-2-aminomethylmorpholine;BUTTPARK 90\06-25;4-BOC-2-AMINOMETHYLMORPHOLINE;4-Morpholinecarboxylic acid, 2-(aMinoMethyl)-, 1,1-diMethylethyl ester;(RS)-4-Boc-2-(aMinoMethyl)Morpholine | | CAS: | 140645-53-0 | | MF: | C10H20N2O3 | | MW: | 216.28 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 140645-53-0.mol |  |
| | 2-Aminomethyl-4-Boc-morpholine Chemical Properties |
| Boiling point | 310.7±27.0 °C(Predicted) | | density | 1.078±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 9.37±0.29(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C10H20N2O3/c1-10(2,3)15-9(13)12-4-5-14-8(6-11)7-12/h8H,4-7,11H2,1-3H3 | | InChIKey | MTMBHUYOIZWQAJ-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCOC(CN)C1 |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN2811 | | Hazard Note | Irritant | | HS Code | 2934999090 |
| | 2-Aminomethyl-4-Boc-morpholine Usage And Synthesis |
| Uses | 4-Boc-(2-aminomethyl)morpholine is used as a reagent in the discovery of novel small molcules that activate satellite cell proliferation and enhance repair of damaged muscle. |
| | 2-Aminomethyl-4-Boc-morpholine Preparation Products And Raw materials |
|