| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2,2',4,4'-Tetramethylbenzophenone manufacturers
|
| | 2,2',4,4'-Tetramethylbenzophenone Basic information |
| Product Name: | 2,2',4,4'-Tetramethylbenzophenone | | Synonyms: | Bis(2,4-dimethylphenyl)methanone;2,2,4,4-TETRAMETHYLBENZOPHENONE 96+%;Methanone, bis(2,4-dimethylphenyl)-;Tetramethylbenzophenone;2,2′,4,4′-Tetramethylbenzophenone, CAS 3478-88-4;2,2',4,4'-tetramethylbenzenemethylone;2,2',4,4'-Tetramethylbenzophenone | | CAS: | 3478-88-4 | | MF: | C17H18O | | MW: | 238.32 | | EINECS: | | | Product Categories: | Aromatic Benzophenones & Derivatives (substituted) | | Mol File: | 3478-88-4.mol |  |
| | 2,2',4,4'-Tetramethylbenzophenone Chemical Properties |
| Melting point | 88-90 °C | | Boiling point | 188 °C / 7mmHg | | density | 1,04 g/cm3 | | refractive index | 1.5830-1.5860 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Yellow to Green | | InChI | InChI=1S/C17H18O/c1-11-5-7-15(13(3)9-11)17(18)16-8-6-12(2)10-14(16)4/h5-10H,1-4H3 | | InChIKey | KFNQSAKXSGGDAA-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C)C=C1C)(C1=CC=C(C)C=C1C)=O |
| Safety Statements | 24/25 | | HS Code | 2914.39.9000 |
| | 2,2',4,4'-Tetramethylbenzophenone Usage And Synthesis |
| | 2,2',4,4'-Tetramethylbenzophenone Preparation Products And Raw materials |
|