Flupentixol decanoate manufacturers
|
| | Flupentixol decanoate Basic information |
| Product Name: | Flupentixol decanoate | | Synonyms: | 1-DECANOLOXY-2-(4-[3-(2-TRIFLUOROMETHYL-THIOXANTHEN-9-YLIDENE)-PROPYL]-PIPERAZIN-1-YL)-ETHANE;FLUPENTIXOL DECANOATE;2-[4-[3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl]-1-piperazinyl]ethyl decanoate;1-DECANOLOXY-2-(4-[3-(S-TRIFLUOROMETHYL-THIOXANTHEN-9-YLIDENE)-PROPYL]-PIPERZAIN-1-YL]-ETHANE;Decanoic acid 2-[4-[3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl]-1-piperazinyl]ethyl ester;(E)-2-(4-(3-(2-(trifluoroMethyl)-9H-thioxanthen-9-ylidene)propyl)piperazin-1-yl)ethyl decanoate;Flupentixol decanoate USP/EP/BP;Flupentixol DecanoateQ: What is
Flupentixol Decanoate Q: What is the CAS Number of
Flupentixol Decanoate Q: What is the storage condition of
Flupentixol Decanoate Q: What are the applications of
Flupentixol Decanoate | | CAS: | 30909-51-4 | | MF: | C33H43F3N2O2S | | MW: | 588.77 | | EINECS: | 250-385-6 | | Product Categories: | | | Mol File: | 30909-51-4.mol |  |
| | Flupentixol decanoate Chemical Properties |
| Boiling point | 648.0±55.0 °C(Predicted) | | density | 1.169±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 7.20±0.10(Predicted) | | form | oil | | Major Application | pharmaceutical pharmaceutical small molecule | | InChIKey | UIKWDDSLMBHIFT-UVHMKAGCSA-N | | SMILES | FC(F)(F)c1cc2c(cc1)Sc3c(cccc3)\C\2=C/CCN4CCN(CC4)CCOC(=O)CCCCCCCCC |
| Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Lact. Repr. 2 |
| | Flupentixol decanoate Usage And Synthesis |
| Uses | Dopamine receptor antagonist; neuroleptic. |
| | Flupentixol decanoate Preparation Products And Raw materials |
|
|
Tag:Flupentixol decanoate(30909-51-4)
Related Product Information
|
|
Propylamine
Dibutyl sebacate
[(3S,9S,10R,13R,14S,17R)-10,13-Dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] decanoate
EQUILIN
Homopiperazine
Bis(2-ethylhexyl) sebacate
Sucrose Fatty Acid Ester
Sebacic acid
Fupentixol dihydrochloride
Ethyl caprate
N-Aminoethylpiperazine
Aluminate coupling agent
Piperazine
N,N-Diisopropylethylamine
Propyl butyrate
2-Ethylhexyl ferulate
Piperacillin
Propyl gallate
|