| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Bromo-5-(trifluoromethoxy)phenol Basic information |
| Product Name: | 2-Bromo-5-(trifluoromethoxy)phenol | | Synonyms: | 2-BROMO-5-(TRIFLUOROMETHOXY)PHENOL,98.0%(GC)(T);1-Bromo-2-hydroxy-4-(trifluoromethoxy)benzene;4-Bromo-3-hydroxy-alpha,alpha,alpha-trifluoroanisole;2-Bromo-5-(trifluoromethoxy)phenol;1-Bromo-2-hydroxy-4-(trifluoromethoxy)benzene
4-Bromo-3-hydroxy-alpha,alpha,alpha-trifluoroanisole;2-Bromo-5-(trifluoromethoxy)phenol >;Phenol,2-bromo-5-(trifluoromethoxy)-，98%;Phenol, 2-bromo-5-(trifluoromethoxy)- | | CAS: | 205371-26-2 | | MF: | C7H4BrF3O2 | | MW: | 257 | | EINECS: | | | Product Categories: | alcohol| alkyl bromide | | Mol File: | 205371-26-2.mol |  |
| | 2-Bromo-5-(trifluoromethoxy)phenol Chemical Properties |
| Boiling point | 209.9±35.0 °C(Predicted) | | density | 1.74 | | refractive index | 1.4815 | | storage temp. | 2-8°C | | form | clear liquid | | pka | 7.29±0.10(Predicted) | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C7H4BrF3O2/c8-5-2-1-4(3-6(5)12)13-7(9,10)11/h1-3,12H | | InChIKey | RHRRKORKKIVAGJ-UHFFFAOYSA-N | | SMILES | C1(O)=CC(OC(F)(F)F)=CC=C1Br |
| Hazard Codes | T | | HS Code | 2909500090 |
| | 2-Bromo-5-(trifluoromethoxy)phenol Usage And Synthesis |
| Chemical Properties | Clear colorless to yellow or pale red liquid
| | Chemical Properties |
2-Bromo-5-(trifluoromethoxy)phenol is used in organic synthesis.
|
| | 2-Bromo-5-(trifluoromethoxy)phenol Preparation Products And Raw materials |
|