| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-Amino-8-bromo-9-isopentyl-5H-purin-6(9H)-one Basic information |
| | 2-Amino-8-bromo-9-isopentyl-5H-purin-6(9H)-one Chemical Properties |
| Boiling point | 493.272±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.804±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | pka | 1.537±0.20(predicted) | | InChI | 1S/C10H14BrN5O/c1-5(2)3-4-16-7-6(13-9(16)11)8(17)15-10(12)14-7/h5H,3-4H2,1-2H3,(H3,12,14,15,17) | | InChIKey | LCAOBEWAVYTFJM-UHFFFAOYSA-N | | SMILES | BrC1=NC2=C(O)N=C(N)N=C2N1CCC(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |
| | 2-Amino-8-bromo-9-isopentyl-5H-purin-6(9H)-one Usage And Synthesis |
| | 2-Amino-8-bromo-9-isopentyl-5H-purin-6(9H)-one Preparation Products And Raw materials |
|