|
|
| | 4-(4-tert-Butyl-phenoxy)-butyric acid Basic information |
| | 4-(4-tert-Butyl-phenoxy)-butyric acid Chemical Properties |
| Boiling point | 210 °C(Press: 20 Torr) | | density | 1.053±0.06 g/cm3(Predicted) | | pka | 4.61±0.10(Predicted) | | form | solid | | InChI | 1S/C14H20O3/c1-14(2,3)11-6-8-12(9-7-11)17-10-4-5-13(15)16/h6-9H,4-5,10H2,1-3H3,(H,15,16) | | InChIKey | SBRAJDSNLRABGN-UHFFFAOYSA-N | | SMILES | O(CCCC(=O)O)c1ccc(cc1)C(C)(C)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-(4-tert-Butyl-phenoxy)-butyric acid Usage And Synthesis |
| | 4-(4-tert-Butyl-phenoxy)-butyric acid Preparation Products And Raw materials |
|