| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-tert-Butylphenoxyacetic acid Basic information |
| Product Name: | 4-tert-Butylphenoxyacetic acid | | Synonyms: | 2-(4-tert-butylphenoxy)ethanoic acid;LABOTEST-BB LT01143377;[4-(1,1-Dimethylethyl)phenoxy]-acetic acid, TAC acid;Acetic acid, [4-(1,1-dimethylethyl)phenoxy]-;P-(TERT-BUTYL)PHENOXYACETIC ACID;p-tert-Butylphenoxyacetic acid;AKOS BBB/265;AKOS B006491 | | CAS: | 1798-04-5 | | MF: | C12H16O3 | | MW: | 208.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1798-04-5.mol |  |
| | 4-tert-Butylphenoxyacetic acid Chemical Properties |
| Melting point | 96 °C(lit.) | | Boiling point | 325.4±25.0 °C(Predicted) | | density | 1.088±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Sparingly Soluble (0.56 g/L) (25°C), Calc. | | pka | 3.22±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | BRN | 2368208 | | InChI | InChI=1S/C12H16O3/c1-12(2,3)9-4-6-10(7-5-9)15-8-11(13)14/h4-7H,8H2,1-3H3,(H,13,14) | | InChIKey | FBIGAJNVRFKBJL-UHFFFAOYSA-N | | SMILES | C(O)(=O)COC1=CC=C(C(C)(C)C)C=C1 | | CAS DataBase Reference | 1798-04-5(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 4-tert-Butylphenoxyacetic acid Usage And Synthesis |
| Uses | Applied as a reagent for the TAC protective group in nucleosides. | | Definition | ChEBI: (4-tert-Butyl-phenoxy)-acetic acid is a monocarboxylic acid. | | Purification Methods | Crystallise the acid from pet ether or pet ether/*C6H6 mixture. [Beilstein 6 H 524, 6 III 1869.] |
| | 4-tert-Butylphenoxyacetic acid Preparation Products And Raw materials |
|