| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(4-Bromophenyl)-3-methyl-1H-pyrazol-5-amine Basic information |
| | 4-(4-Bromophenyl)-3-methyl-1H-pyrazol-5-amine Chemical Properties |
| Melting point | 133-138℃ | | Boiling point | 415.2±45.0 °C(Predicted) | | density | 1.565±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 15.17±0.50(Predicted) | | form | powder | | Appearance | White to off-white Solid | | InChI | 1S/C10H10BrN3/c1-6-9(10(12)14-13-6)7-2-4-8(11)5-3-7/h2-5H,1H3,(H3,12,13,14) | | InChIKey | XBGQAVPNQRLZOV-UHFFFAOYSA-N | | SMILES | Cc1n[nH]c(N)c1-c2ccc(Br)cc2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-41 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-(4-Bromophenyl)-3-methyl-1H-pyrazol-5-amine Usage And Synthesis |
| | 4-(4-Bromophenyl)-3-methyl-1H-pyrazol-5-amine Preparation Products And Raw materials |
|