|
|
| | 4-(4-Chloro-phenyl)-5-methyl-2H-pyrazol-3-ylamine Basic information |
| Product Name: | 4-(4-Chloro-phenyl)-5-methyl-2H-pyrazol-3-ylamine | | Synonyms: | 4-(4-CHLOROPHENYL)-3-METHYL-1H-PYRAZOL-5-AMINE;AKOS BBS-00005783;ASISCHEM C58484;TIMTEC-BB SBB011182;4-(4-chlorophenyl)-3-methyl-1H-pyrazol-5-amine(SALTDATA: FREE);[4-(4-chlorophenyl)-5-methyl-1H-pyrazol-3-yl]amine;4-(4-chlorophenyl)-5-methyl-1H-pyrazol-3-amine;Pyrazol-5-amine, 4-(4-chlorophenyl)-3-methyl- | | CAS: | 214416-39-4 | | MF: | C10H10ClN3 | | MW: | 207.66 | | EINECS: | | | Product Categories: | | | Mol File: | 214416-39-4.mol |  |
| | 4-(4-Chloro-phenyl)-5-methyl-2H-pyrazol-3-ylamine Chemical Properties |
| form | solid | | InChI | 1S/C10H10ClN3/c1-6-9(10(12)14-13-6)7-2-4-8(11)5-3-7/h2-5H,1H3,(H3,12,13,14) | | InChIKey | PIYGPVNFVWLQAG-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)c2c([nH]nc2C)N |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 4-(4-Chloro-phenyl)-5-methyl-2H-pyrazol-3-ylamine Usage And Synthesis |
| | 4-(4-Chloro-phenyl)-5-methyl-2H-pyrazol-3-ylamine Preparation Products And Raw materials |
|