| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane, 95% Basic information |
| Product Name: | Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane, 95% | | Synonyms: | 1,2-Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane;Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane, 95%;(2-methoxyphenyl)-[(2-methoxyphenyl)-dimethylsilyl]-dimethylsilane;bis(2-methoxyphenyl)tetramethyldisilane;Disilane, 1,2-bis(2-methoxyphenyl)-1,1,2,2-tetramethyl-;1,2-Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane | | CAS: | 332343-84-7 | | MF: | C18H26O2Si2 | | MW: | 330.57 | | EINECS: | | | Product Categories: | | | Mol File: | 332343-84-7.mol |  |
| | Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane, 95% Chemical Properties |
| Boiling point | 139-144°C/4mm | | density | 1.0297 g/mL at 25 °C | | refractive index | n20/D1.5673 | | Fp | 139-144°C/4mm | | Specific Gravity | 1.030 | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/C18H26O2Si2/c1-19-15-11-7-9-13-17(15)21(3,4)22(5,6)18-14-10-8-12-16(18)20-2/h7-14H,1-6H3 | | InChIKey | GTVBFJHBCZGREK-UHFFFAOYSA-N | | SMILES | COc1ccccc1[Si](C)(C)[Si](C)(C)c2ccccc2OC |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane, 95% Usage And Synthesis |
| Uses | The lithium reagent derived from this disilane can be used to install a C-Si bond, easily cleaved by Tamao-Fleming oxidation. |
| | Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane, 95% Preparation Products And Raw materials |
|