| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
- 6-Bromooxindole
-
- $122.00
-
2026-09-02
- CAS:99365-40-9
- Min. Order: 1KG
- Purity: 99%
- 6-Bromo-2-Oxyindole
-
- $5.00
-
2026-05-28
- CAS:99365-40-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | 6-Bromo-1,3-dihydro-2H-indol-2-one Basic information |
| | 6-Bromo-1,3-dihydro-2H-indol-2-one Chemical Properties |
| Melting point | 217-221 °C(lit.) | | Boiling point | 343.6±42.0 °C(Predicted) | | density | 1.666±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSo | | form | Solid | | pka | 13.39±0.20(Predicted) | | color | Orange | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C8H6BrNO/c9-6-2-1-5-3-8(11)10-7(5)4-6/h1-2,4H,3H2,(H,10,11) | | InChIKey | JARRYVQFBQVOBE-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(Br)=C2)CC1=O | | CAS DataBase Reference | 99365-40-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 6-Bromo-1,3-dihydro-2H-indol-2-one Usage And Synthesis |
| Chemical Properties | Light yelllow crystal | | Uses | 6-Bromo-2-Oxindole is an indolinone derivative used for the preparation of p38α inhibitors as potential antiinflammatories. | | Uses | 6-Bromooxindole derivative is used in the preparation of p38alpha inhibitors as potential anti- inflammatories. It is used as an intermediate in pharmaceuticals. | | Synthesis | The 2,5-dibromonitrobenzene was dissolved in DMF, ethyl acetoacetate and potassium carbonate were added and the reaction was carried out at 80 degrees Celsius; after that, 3 equivalents of iron were added and the reaction was carried out at 120 degrees Celsius in glacial acetic acid, which ultimately gave 6-bromo-1,3-dihydro-2H-indol-2-one) in 90% yield. |
| | 6-Bromo-1,3-dihydro-2H-indol-2-one Preparation Products And Raw materials |
|