| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-(tert-Butyldimethylsilyloxy)-2-propanone Basic information |
| | 1-(tert-Butyldimethylsilyloxy)-2-propanone Chemical Properties |
| Boiling point | 35-38 °C/0.6 mmHg (lit.) | | density | 0.976 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.426(lit.) | | Fp | 165 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless | | Specific Gravity | 0.976 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C9H20O2Si/c1-8(10)7-11-12(5,6)9(2,3)4/h7H2,1-6H3 | | InChIKey | LHYDYTSJUGPFLA-UHFFFAOYSA-N | | SMILES | CC(=O)CO[Si](C)(C)C(C)(C)C |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids |
| | 1-(tert-Butyldimethylsilyloxy)-2-propanone Usage And Synthesis |
| Uses | 1-(tert-Butyldimethylsilyloxy)-2-propanone is also known as 1-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}acetone. Its enthalpy of vaporization at boiling point has been reported. | | General Description | 1-(tert-Butyldimethylsilyloxy)-2-propanone is also known as 1-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}acetone. Its enthalpy of vaporization at boiling point has been reported. |
| | 1-(tert-Butyldimethylsilyloxy)-2-propanone Preparation Products And Raw materials |
|