| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Sudan IV-d6 CAS:1014689-18-9 Package:50Mg,5Mg
|
| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:Sudan IV-d6 CAS:1014689-18-9 Purity:对照品 Package:10mg~500mg Remarks:CC000130D01
|
| Company Name: |
Chemsky (shanghai) International Co.,Ltd
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:Sudan IV-d6;1-[2-[2-Methyl-4-[2-(2-Methylphenyl)diazenyl]phenyl]diazenyl]-2-naphthalenol-d6; 1-(2'-Methyl-4'-(2''-Methylphenylazo)phenylazo)-2-naphthol-d6; 1-[4-(o-Tolylazo)-o-tolylazo]-2-naphthol-d6; CAS:1014689-18-9 Purity:98+% Package:1Mg;5Mg;10Mg;50Mg;100Mg;500Mg
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Sudan-IV-D6 CAS:1014689-18-9 Remarks:CS-W-00164
|
|
| | SUDAN IV-D6 Basic information |
| Product Name: | SUDAN IV-D6 | | Synonyms: | SUDAN IV-D6;1-[2-METHYL-4-(2-METHYL-PHENYLAZO)-PHENYLAZO]-2-NAPHTHOL-D6;1-[2-Methyl-4-(2-methyl-phenylazo)-phenylazo]-2-naphthol-d6 solution;Sudan IV-d6 solution;Sudan 4 D6 (naphthyl D6);1-[2-[2-Methyl-4-[2-(2-Methylphenyl)diazenyl]phenyl]diazenyl]-2-naphthalenol-d6;1-[4-(o-Tolylazo)-o-tolylazo]-2-naphthol-d6;1-[2-[2-Methyl-4-[2-(2-methylphenyl)diazenyl]phenyl]diazenyl]-2-naphthalen-3,4,5,6,7,8-d6-ol | | CAS: | 1014689-18-9 | | MF: | C24H20N4O | | MW: | 380.45 | | EINECS: | 200-835-2 | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Isotope Labelled Compounds;Pharmaceuticals | | Mol File: | Mol File |  |
| | SUDAN IV-D6 Chemical Properties |
| Fp | 2 °C | | Major Application | cleaning products cosmetics environmental food and beverages personal care | | InChI | 1S/C24H20N4O/c1-16-7-3-6-10-21(16)26-25-19-12-13-22(17(2)15-19)27-28-24-20-9-5-4-8-18(20)11-14-23(24)29/h3-15,29H,1-2H3/b26-25+,28-27+/i4D,5D,8D,9D,11D,14D | | InChIKey | RCTGMCJBQGBLKT-GDXALTGDSA-N | | SMILES | [2H]c1c([2H])c([2H])c2c(\N=N\c3ccc(cc3C)\N=N\c4ccccc4C)c(O)c([2H])c([2H])c2c1[2H] |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22-36 | | Safety Statements | 26-36/37-16 | | RIDADR | UN1648 3/PG 2 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | SUDAN IV-D6 Usage And Synthesis |
| Uses | (Sudan Iv-D6) Labelled Sudan IV. It has been used to promote wound healing. Biological stain. | | Uses | Labelled Sudan IV. It has been used to promote wound healing. Biological stain. Dyes and metabolites, Environmental Testing |
| | SUDAN IV-D6 Preparation Products And Raw materials |
|