| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
|
| | 1,N6-Etheno NAD Basic information |
| Product Name: | 1,N6-Etheno NAD | | Synonyms: | 1,N6-Etheno NAD, 1,N6-Ethenonicotinamide adenine dinucleotide;3-(AMinocarbonyl)-1-[5-O-[hydroxy(phosphonooxy)phosphinyl]-β-D-ribofuranosyl]pyridiniuM Inner Salt P'5'-Ester with 3-β-D-Ribofuranosyl-3H-iMidazo[2,1-i]purine;1,N6-ETHENONICOTINAMIDE ADENINE DINUCLEOTIDE;N6-Etheno NAD;Nicotinamide 1,N6-ethenoadenine dinucleotide;Adenosine, 2-amino-2′-O-hexadecyl- (ACI);NICOTINAMIDE 1,N6-ETHENOADENINE DINUCLEOTIDE;1,N6-Etheno NAD | | CAS: | 38806-38-1 | | MF: | C23H27N7O14P2 | | MW: | 687.45 | | EINECS: | | | Product Categories: | Aromatics;Bases & Related Reagents;Intermediates & Fine Chemicals;Nicotine Derivatives;Nucleotides;Pharmaceuticals | | Mol File: | 38806-38-1.mol |  |
| | 1,N6-Etheno NAD Chemical Properties |
| Melting point | >148°C (dec.) | | storage temp. | -20°C | | solubility | Methanol (Slightly, Heated, Sonicated), Water (Slightly) | | form | Solid | | color | White to Off-White | | biological source | synthetic (Organic) | | Water Solubility | H2O: soluble-250mg/mL, clear, colorless to faintly yellow | | Stability: | Hygroscopic | | InChIKey | AVLUSNAXLARRGJ-UHFFFAOYSA-N | | SMILES | NC(=O)C1=CC=C[N](=C1)C2OC(COP(O)(=O)OP(O)(=O)OCC3OC(C(O)C3O)n4cnc5c4ncn6ccnc56)C(O)C2O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,N6-Etheno NAD Usage And Synthesis |
| Uses | A fluorescent analog of Nicotinamide Adenine Dinucleotide as a coenzyme for glutamate dehydrogenase. | | Uses | Nicotinamide 1,N6-ethenoadenine dinucleotide (ε-NAD) is an NAD fluorescent analog (fluorophore) that may be used to study ADP-ribosylation reactions and the structure/kinetics of NAD+ binding enzymes by assays such as etheno-NAD+ assay. |
| | 1,N6-Etheno NAD Preparation Products And Raw materials |
|