| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
|
| | 5,6-Dihydro-1-benzothiophene-7(4H)-one Basic information |
| Product Name: | 5,6-Dihydro-1-benzothiophene-7(4H)-one | | Synonyms: | RARECHEM AK MA K002;5,6-dihydro-1-benzothiophen-7(4H)-one;5,6-dihydro-4H-1-benzothiophen-7-one;Benzo[b]thiophen-7(4H)-one, 5,6-dihydro-;5,6-DIHYDROBENZO[B]THIOPHEN-7(4H)-ONE;5,6-Dihydro-1-benzothiophene-7(4H)-one | | CAS: | 1468-84-4 | | MF: | C8H8OS | | MW: | 152.21 | | EINECS: | | | Product Categories: | | | Mol File: | 1468-84-4.mol |  |
| | 5,6-Dihydro-1-benzothiophene-7(4H)-one Chemical Properties |
| Melting point | 36-38 °C | | Boiling point | 97-103 °C(Press: 1 Torr) | | density | 1.245±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Yellow to brown Liquid | | InChI | InChI=1S/C8H8OS/c9-7-3-1-2-6-4-5-10-8(6)7/h4-5H,1-3H2 | | InChIKey | JEJQJCKVMQVOHZ-UHFFFAOYSA-N | | SMILES | C12SC=CC=1CCCC2=O |
| | 5,6-Dihydro-1-benzothiophene-7(4H)-one Usage And Synthesis |
| Uses | 5,6-Dihydrobenzo[b]thiophen-7(4H)-one is an intermediate used to prepare thiadiaminooxopyrimidine derivatives with antitumor activities. It is also used to synthesize (aminoalkyl)benzo- and -thienocycloalkanones as atypical antipsychotics. | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 2, p. 44, 1965 DOI: 10.1002/jhet.5570020109
Tetrahedron Letters, 16, p. 2885, 1975 |
| | 5,6-Dihydro-1-benzothiophene-7(4H)-one Preparation Products And Raw materials |
|