| Company Name: |
langwaychem Gold |
| Tel: |
21-67639201 13601755340 |
| Email: |
customer@langwaychem.com |
| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Methyl 1-cyclohexene-1-carboxylate Basic information |
| | Methyl 1-cyclohexene-1-carboxylate Chemical Properties |
| Boiling point | 190-192 °C | | density | 1.028 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.477 | | Fp | 165 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Clear colorless | | Water Solubility | insoluble | | BRN | 1071971 | | InChI | InChI=1S/C8H12O2/c1-10-8(9)7-5-3-2-4-6-7/h5H,2-4,6H2,1H3 | | InChIKey | KXPWRCPEMHIZGU-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)CCCCC=1 | | CAS DataBase Reference | 18448-47-0(CAS DataBase Reference) | | NIST Chemistry Reference | Methyl 1-cyclohexene-1-carboxylate(18448-47-0) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 10-23 | | HS Code | 29162090 | | Storage Class | 10 - Combustible liquids |
| | Methyl 1-cyclohexene-1-carboxylate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Methyl 1-cyclohexene-1-carboxylate is used in the diastereoselective synthesis of cis-1,2-dialkenylcyclopropanols and methyl -7,7-dimethyl-9-oxo-1,3,4,4a,6,7,8,9,9b-decahydrodibenzo[b,d]furan-4a-carboxylate. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 33, p. 1550, 1968 DOI: 10.1021/jo01268a053
Tetrahedron Letters, 17, p. 453, 1976 |
| | Methyl 1-cyclohexene-1-carboxylate Preparation Products And Raw materials |
|