| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-[4-(Dimethylamino)phenyl]propanoic acid Basic information |
| Product Name: | 3-[4-(Dimethylamino)phenyl]propanoic acid | | Synonyms: | CHEMBRDG-BB 4013887;AKOS BB-9212;3-(4-DIMETHYLAMINO-PHENYL)-PROPIONIC ACID;3-[4-(dimethylamino)phenyl]propanoic acid hydrochloride;benzenepropanoic acid, 4-(dimethylamino)-;3-[4-(dimethylamino)phenyl]propanoic acid(SALTDATA: HCl);4-(Dimethylamino)benzenepropanoic acid;3-[4-(Dimethylamino)phenyl]propanoic acid | | CAS: | 73718-09-9 | | MF: | C11H15NO2 | | MW: | 193.24 | | EINECS: | | | Product Categories: | | | Mol File: | 73718-09-9.mol | ![3-[4-(Dimethylamino)phenyl]propanoic acid Structure](CAS/GIF/73718-09-9.gif) |
| | 3-[4-(Dimethylamino)phenyl]propanoic acid Chemical Properties |
| Melting point | 184-185 °C | | Boiling point | 341.6±17.0 °C(Predicted) | | density | 1.127±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 4.53±0.10(Predicted) | | Appearance | Brown to reddish brown Solid | | InChI | 1S/C11H15NO2.ClH/c1-12(2)10-6-3-9(4-7-10)5-8-11(13)14;/h3-4,6-7H,5,8H2,1-2H3,(H,13,14);1H | | InChIKey | WYNBFJDEOYTIGZ-UHFFFAOYSA-N | | SMILES | O=C(O)CCC1=CC=C(C=C1)N(C)C.[H]Cl |
| Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 3-[4-(Dimethylamino)phenyl]propanoic acid Usage And Synthesis |
| | 3-[4-(Dimethylamino)phenyl]propanoic acid Preparation Products And Raw materials |
|