|
|
| | 5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine Basic information |
| | 5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine Chemical Properties |
| Melting point | 228-229°C | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | Appearance | Off-white to pink Solid | | InChI | InChI=1S/C7H4ClIN2/c8-4-1-5-6(9)3-11-7(5)10-2-4/h1-3H,(H,10,11) | | InChIKey | LZTOGEVTAZHIFX-UHFFFAOYSA-N | | SMILES | C12NC=C(I)C1=CC(Cl)=CN=2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine Usage And Synthesis |
| | 5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine Preparation Products And Raw materials |
|