|
|
| | Benzoic acid, 4-[(1S)-1-aminoethyl]-, methyl ester Basic information | | Physical Form |
| Product Name: | Benzoic acid, 4-[(1S)-1-aminoethyl]-, methyl ester | | Synonyms: | Benzoic acid, 4-[(1S)-1-aminoethyl]-, methyl ester;(S)-4-(1-AMino-ethyl)-benzoic acid Methyl ester;4-[(1S)-1-Aminoethyl]benzoic acid methyl ester;(1S)-1-[4-(Methoxycarbonyl)phenyl]ethylamine, (S)-4-(Methoxycarbonyl)-alpha-methylbenzylamine;Methyl 4-((S)-1-aminoethyl)benzoate;Benzoic acid, 4-[(1S)-1-aminoethyl]-, methyl ester (9CI, ACI);4-[(1S)-1-aminoethyl]-Benzoic acid methyl ester (9CI ACI);methyl (S)-4-(1-aminoethyl)benzoate | | CAS: | 222714-37-6 | | MF: | C10H13NO2 | | MW: | 179.22 | | EINECS: | | | Product Categories: | | | Mol File: | 222714-37-6.mol | ![Benzoic acid, 4-[(1S)-1-aminoethyl]-, methyl ester Structure](CAS/GIF/222714-37-6.gif) |
| | Benzoic acid, 4-[(1S)-1-aminoethyl]-, methyl ester Chemical Properties |
| Melting point | 60-62° | | Boiling point | 281.5±15.0 °C(Predicted) | | density | 1.089±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | 8+-.0.10(Predicted) | | color | Off-white | | InChI | InChI=1S/C10H13NO2/c1-7(11)8-3-5-9(6-4-8)10(12)13-2/h3-7H,11H2,1-2H3/t7-/m0/s1 | | InChIKey | XSYGLHLLQZGWPT-ZETCQYMHSA-N | | SMILES | C(OC)(=O)C1=CC=C([C@@H](N)C)C=C1 |
| | Benzoic acid, 4-[(1S)-1-aminoethyl]-, methyl ester Usage And Synthesis |
| Physical Form | White to Yellow Solid | | Uses | Methyl 4-[(1S)-1-Aminoethyl] benzoate is a reactant used in the preparation of prostanoid EP4 receptor antagonist which may be used in the treatment of osteoporosis, neurological disorders and cardiovascular diseases. |
| | Benzoic acid, 4-[(1S)-1-aminoethyl]-, methyl ester Preparation Products And Raw materials |
|