|
|
| | 2',4',6',3,4-Pentahydroxychalcone Basic information |
| Product Name: | 2',4',6',3,4-Pentahydroxychalcone | | Synonyms: | 3,4,2',4',6'-PENTAHYDROXYCHALCONE;(E)-3-(3,4-Dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one;PENTAHYDROXYCHALCONE,2',4',6',3,4-;PENTAHYDROXYCHALCONE,2',4',6',3,4-(SH);3,4,2'',4'',6''-PENTAHYDROXYCHALCONE WITH HPLC;PENTADECANE, n-(RG);2-Propen-1-one,3-(3,4-dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-, (2E)-;(2E)-3-(3,4-Dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-2-propen-1-one | | CAS: | 14917-41-0 | | MF: | C15H12O6 | | MW: | 288.25 | | EINECS: | | | Product Categories: | | | Mol File: | 14917-41-0.mol |  |
| | 2',4',6',3,4-Pentahydroxychalcone Chemical Properties |
| Melting point | 157-158 °C | | Boiling point | 595.908±50.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.584±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | pka | 6.879±0.40(predicted) | | InChI | InChI=1S/C15H12O6/c16-9-6-13(20)15(14(21)7-9)11(18)4-2-8-1-3-10(17)12(19)5-8/h1-7,16-17,19-21H/b4-2+ | | InChIKey | CRBYNQCDRNZCNX-DUXPYHPUSA-N | | SMILES | C(C1=C(O)C=C(O)C=C1O)(=O)/C=C/C1=CC=C(O)C(O)=C1 | | LogP | 2.680 (est) |
| | 2',4',6',3,4-Pentahydroxychalcone Usage And Synthesis |
| Uses | Eriodictyol chalcone possesses both anti-aromatase and an anti-17β-HSD activity[1]. | | Definition | ChEBI: 2',3,4,4',6'-pentahydroxychalcone is a member of the class of chalcones that is chalcone substituted by hydroxy groups at positions 2', 3, 4, 4', and 6'. It is functionally related to a chalcone. It is a conjugate acid of a 2',3,4,4',6'-pentahydroxychalcone(1-). | | IC 50 | Aromatase | | References | [1] J C Le Bail, et al. Chalcones are potent inhibitors of aromatase and 17beta-hydroxysteroid dehydrogenase activities. Life Sci. 2001 Jan 5;68(7):751-61. DOI:10.1016/s0024-3205(00)00974-7 |
| | 2',4',6',3,4-Pentahydroxychalcone Preparation Products And Raw materials |
|