|
|
| | 4-Bromoindole-2-carboxylic acid ethyl ester Basic information |
| Product Name: | 4-Bromoindole-2-carboxylic acid ethyl ester | | Synonyms: | 4-Bromoindole-2-carboxylic acid ethyl ester;4-Bromo-1H-indole-2-carboxylic acid ethyl ester;1H-Indole-2-carboxylic acid, 4-broMo-, ethyl ester;4-bromo-1H-indole-2-carboxylate;Ethyl 4-Bromoindole-2-carboxylate;Ethyl 4-bromo-1H-indole-2-carboxylate | | CAS: | 103858-52-2 | | MF: | C11H10BrNO2 | | MW: | 268.11 | | EINECS: | | | Product Categories: | | | Mol File: | 103858-52-2.mol |  |
| | 4-Bromoindole-2-carboxylic acid ethyl ester Chemical Properties |
| Boiling point | 394.7±22.0 °C(Predicted) | | density | 1.554 | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.08±0.30(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C11H10BrNO2/c1-2-15-11(14)10-6-7-8(12)4-3-5-9(7)13-10/h3-6,13H,2H2,1H3 | | InChIKey | KNPDUPLMXYEJAU-UHFFFAOYSA-N | | SMILES | N1C2=C(C(Br)=CC=C2)C=C1C(OCC)=O |
| | 4-Bromoindole-2-carboxylic acid ethyl ester Usage And Synthesis |
| | 4-Bromoindole-2-carboxylic acid ethyl ester Preparation Products And Raw materials |
|