|
|
| | 4-(5-Chloro-2-methoxy-phenyl)-thiazol-2-ylamine Basic information |
| Product Name: | 4-(5-Chloro-2-methoxy-phenyl)-thiazol-2-ylamine | | Synonyms: | 4-(5-CHLORO-2-METHOXYPHENYL)-1,3-THIAZOL-2-YLAMINE;ASINEX-REAG BAS 12767619;4-(5-Chloro-2-methoxyphenyl)thiazol-2-amine;2-Thiazolamine, 4-(5-chloro-2-methoxyphenyl)-;4-(5-Chloro-2-methoxy-phenyl)-thiazol-2-ylamine | | CAS: | 303019-72-9 | | MF: | C10H9ClN2OS | | MW: | 240.71 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-(5-Chloro-2-methoxy-phenyl)-thiazol-2-ylamine Chemical Properties |
| Boiling point | 385.5±27.0 °C(Predicted) | | density | 1.370±0.06 g/cm3(Predicted) | | pka | 3.93±0.10(Predicted) | | form | solid | | InChI | 1S/C10H9ClN2OS/c1-14-9-3-2-6(11)4-7(9)8-5-15-10(12)13-8/h2-5H,1H3,(H2,12,13) | | InChIKey | AGQWSHSVUYUBQR-UHFFFAOYSA-N | | SMILES | NC1=NC(C2=CC(Cl)=CC=C2OC)=CS1 |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4-(5-Chloro-2-methoxy-phenyl)-thiazol-2-ylamine Usage And Synthesis |
| | 4-(5-Chloro-2-methoxy-phenyl)-thiazol-2-ylamine Preparation Products And Raw materials |
|