|
|
| | 4-(2-Methoxy-phenyl)-thiazol-2-ylamine Basic information |
| Product Name: | 4-(2-Methoxy-phenyl)-thiazol-2-ylamine | | Synonyms: | TIMTEC-BB SBB011148;ASINEX-REAG BAS 12365880;AKOS BBS-00008014;4-(2-Methoxyphenyl)thiazol-2-amine;2-amino-4-(2-methoxyphenyl)-1,3-thiazole;2-Amino-4-(2-methoxyphenyl)thiazole;2-Thiazolamine, 4-(2-methoxyphenyl)-;4-(2-Methoxy-phenyl)-thiazol-2-ylamine | | CAS: | 93209-95-1 | | MF: | C10H10N2OS | | MW: | 206.26 | | EINECS: | | | Product Categories: | | | Mol File: | 93209-95-1.mol |  |
| | 4-(2-Methoxy-phenyl)-thiazol-2-ylamine Chemical Properties |
| Boiling point | 355.0±17.0 °C(Predicted) | | density | 1.259±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | solid | | pka | 4.40±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C10H10N2OS/c1-13-9-5-3-2-4-7(9)8-6-14-10(11)12-8/h2-6H,1H3,(H2,11,12) | | InChIKey | DVVAVWNGAFFCNW-UHFFFAOYSA-N | | SMILES | NC1=NC(C2=CC=CC=C2OC)=CS1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-(2-Methoxy-phenyl)-thiazol-2-ylamine Usage And Synthesis |
| | 4-(2-Methoxy-phenyl)-thiazol-2-ylamine Preparation Products And Raw materials |
|