|
|
| | Pyrimitate Basic information |
| Product Name: | Pyrimitate | | Synonyms: | ici29661;phosphorothioicacid,o-(2-(dimethylamino)-6-methyl-4-pyrimidinyl)o,o-diethyl;pyrimital;DIOTHYL;Pyrimithate;I.C.I.SUMMERSHEEPDIP;Thiophosphoric acid O,O-diethyl O-[2-(dimethylamino)-4-methylpyrimidin-6-yl] ester;Thiophosphoric acid O-[2-(dimethylamino)-6-methyl-4-pyrimidinyl]O,O-diethyl ester | | CAS: | 5221-49-8 | | MF: | C11H20N3O3PS | | MW: | 305.33 | | EINECS: | 226-020-1 | | Product Categories: | | | Mol File: | 5221-49-8.mol |  |
| | Pyrimitate Chemical Properties |
| Melting point | <25 °C | | Boiling point | bp0.04 128-132° | | density | 1.229±0.06 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 4.88±0.10(Predicted) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C11H20N3O3PS/c1-6-15-18(19,16-7-2)17-10-8-9(3)12-11(13-10)14(4)5/h8H,6-7H2,1-5H3 | | InChIKey | MLDVVJZNWASRQL-UHFFFAOYSA-N | | SMILES | P(=S)(OCC)(OCC)OC1C=C(C)N=C(N(C)C)N=1 |
| RIDADR | 3018 | | HazardClass | 6.1(b) | | PackingGroup | III |
| | Pyrimitate Usage And Synthesis |
| Chemical Properties | Colorless liquid. Soluble in ace-
tone, alcohol, and benzene; almost insoluble in
water. | | Uses | Insecticide, acaricide. | | Definition | A diethyl ester of
phosphoric acid. | | Hazard | Cholinesterase inhibitor. |
| | Pyrimitate Preparation Products And Raw materials |
|