| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (S)-(-)-3,7-Dimethyl-6-octenoic acid Basic information |
| Product Name: | (S)-(-)-3,7-Dimethyl-6-octenoic acid | | Synonyms: | (s)-(-)-citronellic;(3S)-3,7-Dimethyl-6-octenoic acid;(S)-(-)-CITRONELLIC ACID;6-Octenoic acid, 3,7-dimethyl-, (3S)-;(3S)-3,7-dimethyloct-6-enoicaci;(S)-(-)-Citronellic acid 98%;(S)-(?)-Citronellic acid;(S)-3,7-dimethyloct-6-enoic acid | | CAS: | 2111-53-7 | | MF: | C10H18O2 | | MW: | 170.25 | | EINECS: | | | Product Categories: | | | Mol File: | 2111-53-7.mol |  |
| | (S)-(-)-3,7-Dimethyl-6-octenoic acid Chemical Properties |
| Boiling point | 115-120 °C/0.4 mmHg (lit.) | | density | 0.926 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.453(lit.) | | Fp | >230 °F | | pka | 4.78±0.10(Predicted) | | form | liquid | | Optical Rotation | [α]25/D 8°, neat | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | 1S/C10H18O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H,11,12)/t9-/m0/s1 | | InChIKey | GJWSUKYXUMVMGX-VIFPVBQESA-N | | SMILES | C[C@@H](CC\C=C(/C)C)CC(O)=O |
| Hazard Codes | Xi | | Risk Statements | 38 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Skin Irrit. 2 |
| | (S)-(-)-3,7-Dimethyl-6-octenoic acid Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | (S)-(-)-Citronellic acid may be used in the synthesis of trisubstituted piperidine substructures of the veratramine and jervine type, that can be building blocks for developing cyclopamine analogs. | | Definition | ChEBI: (S)-citronellic acid is a citronellic acid that has (S)-configuration. It is a conjugate acid of a (S)-citronellate. It is an enantiomer of a (R)-citronellic acid. |
| | (S)-(-)-3,7-Dimethyl-6-octenoic acid Preparation Products And Raw materials |
|