| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | [Tris(2,4-di-tert-butylphenyl)phosphite]gold chloride Basic information |
| | [Tris(2,4-di-tert-butylphenyl)phosphite]gold chloride Chemical Properties |
| Melting point | 200-202 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder | | InChIKey | GCWCLHMEYZKZRO-UHFFFAOYSA-M | | SMILES | Cl[Au].CC(C)(C)c1ccc(OP(Oc2ccc(cc2C(C)(C)C)C(C)(C)C)Oc3ccc(cc3C(C)(C)C)C(C)(C)C)c(c1)C(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | [Tris(2,4-di-tert-butylphenyl)phosphite]gold chloride Usage And Synthesis |
| Uses | Gold Catalysts — 21st Century ′Gold Rush′
- Intermolecular addition of carbon nucleophiles to 1,5 and 1,6 enynes
Catalyst for:
- [4C+2C] cycloadditions
- Cis-selective single-cleavagte skeletal cycloisomerization
- Diastereoselective Au-catalyzed intermolecular cyclopropanation
- Elucidating the mechanism of "endocyclic" skeletal rearrangement of 1,6-enynes
- Addition reactions
| | reaction suitability | core: gold reagent type: catalyst |
| | [Tris(2,4-di-tert-butylphenyl)phosphite]gold chloride Preparation Products And Raw materials |
|