| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
SunaTech Inc. |
| Tel: |
0512-62872180 18994314770 |
| Email: |
sales@sunatech.com |
Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile manufacturers
|
| | Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile Basic information |
| Product Name: | Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile | | Synonyms: | Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile;REF DUPL: PPDN;2,3-Dicarbonitrilopyrazino[2,3-f][1,10]phenanthroline;2,3-Dicyanodipyrido[3,2-f:2',3'-h]quinoxaline;PPDN , Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitril;Dipyrazino[2,3-f :2',3'-h ]quinoxaline-2,3,6,7,10,11-hexacarbonitrile;PPDN, Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile;Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile (PPDN) | | CAS: | 215611-93-1 | | MF: | C16H6N6 | | MW: | 282.26 | | EINECS: | 200-110-4 | | Product Categories: | | | Mol File: | 215611-93-1.mol | ![Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile Structure](CAS/GIF/215611-93-1.gif) |
| | Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile Chemical Properties |
| Melting point | >250 °C(Solv: ethanol (64-17-5)) | | Boiling point | 654.1±55.0 °C(Predicted) | | density | 1.54 | | storage temp. | 2-8°C | | pka | -5.11±0.50(Predicted) | | form | crystals/powder | | color | White | | InChI | InChI=1S/C16H6N6/c17-7-11-12(8-18)22-16-10-4-2-6-20-14(10)13-9(15(16)21-11)3-1-5-19-13/h1-6H | | InChIKey | LYKXFSYCKWNWEZ-UHFFFAOYSA-N | | SMILES | N1C2C(=C3N=C(C#N)C(C#N)=NC3=C3C=2N=CC=C3)C=CC=1 | | Absorption | λmax 307 nm in DCM | | Fluorescene | λmax 487 nm in DCM |
| | Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile Usage And Synthesis |
| Description | PPDN has a chemical structure of phenanthroline in conjugation with dicarbonitrile-substituted pyrazine. As PPDN is electron-deficient, it can be used as an electron-transport layer (ETL) or hole-injection layer (HIL) material in organic electronic devices. |
| | Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile Preparation Products And Raw materials |
|