| Company Name: |
Energy Chemical
|
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:trans-1-Decalone
CAS:21370-71-8
Purity:98% Package:1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:trans-1-Decalone
CAS:21370-71-8
Purity:98% Package:1G Remarks:156655-1G
|
|
| | TRANS-1-DECALONE Basic information |
| Product Name: | TRANS-1-DECALONE | | Synonyms: | 1-Decalone, trans-;Octahydro-1(2H)-naphthalenone;Octahydro-2H-naphthalen-1-one;trans-alpha-Decalone;trans-Bicyclo[4.4.0]decan-2-one;trans-Decalone;trans-Decalone-1;TRANS-1-DECALONE | | CAS: | 21370-71-8 | | MF: | C10H16O | | MW: | 152.23 | | EINECS: | 244-352-5 | | Product Categories: | | | Mol File: | 21370-71-8.mol |  |
| | TRANS-1-DECALONE Chemical Properties |
| Melting point | 30-32 °C(lit.) | | Boiling point | 73 °C1 mm Hg(lit.) | | density | 0.9860 | | refractive index | 1.4849 (estimate) | | Fp | 196 °F | | InChI | 1S/C10H16O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h8-9H,1-7H2/t8-,9+/m1/s1 | | InChIKey | AFEFRXAPJRCTOW-BDAKNGLRSA-N | | SMILES | [H][C@]12CCCC[C@]1([H])C(=O)CCC2 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | TRANS-1-DECALONE Usage And Synthesis |
| Chemical Properties | White to faintly yellow low melting solid | | Uses | trans-1-Decalone is a chemical compound that has antimicrobial and antioxidant activity of essential oils isolated from Citrus aurantium. | | Uses | The product has been used to study its proton resonance spectra using NMR. |
| | TRANS-1-DECALONE Preparation Products And Raw materials |
|