Kojibiose manufacturers
- KOJIBIOSE
-
-
2026-07-08
- CAS:2140-29-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kg
- KOJIBIOSE
-
- $1.00
-
2020-01-13
- CAS:2140-29-6
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | Kojibiose Basic information |
| Product Name: | Kojibiose | | Synonyms: | 2-O-ALPHA-D-GLUCOPYRANOSYL-D-GLUCOSE;2-O-A-D-GLUCOPYRANOSYL-A-D-GLUCOPYRANOSE;ALPHA-D-GLC-[1->2]-D-GLC;ALPHA-D-KOJIBIOSE;α-d-glc-(1→2)-d-glc;2-O-α-D-Glucopyranosyl-D-glucose;α-D-Glc-(1-2)-D-Glc, 2-O-α-D-Glucopyranosyl-D-glucose;(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanal | | CAS: | 2140-29-6 | | MF: | C12H22O11 | | MW: | 342.3 | | EINECS: | | | Product Categories: | | | Mol File: | 2140-29-6.mol |  |
| | Kojibiose Chemical Properties |
| Melting point | 174.5℃ | | Boiling point | 783.7±60.0 °C(Predicted) | | density | 1.68±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 12.79±0.70(Predicted) | | color | White to Off-White | | Optical Rotation | +162 → +137 | | Water Solubility | water: 5mg/mL, clear, colorless | | Stability: | Hygroscopic | | InChI | 1S/C12H22O11/c13-1-4(16)7(17)8(18)5(2-14)22-12-11(21)10(20)9(19)6(3-15)23-12/h2,4-13,15-21H,1,3H2 | | InChIKey | PZDOWFGHCNHPQD-UHFFFAOYSA-N | | SMILES | OCC(O)C(O)C(O)C(OC1OC(CO)C(O)C(O)C1O)C=O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | Kojibiose Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Kojibiose was studied for the possibility as an early biochemical indicator to diabetes from a study where mice and their levels of kojibiose were examined. | | Definition | ChEBI: Kojibiose is a glycosylglucose. | | Biological Activity | Kojibiose is an inhibitor of plant glucosidase I. It inhibits the removal of terminal glucose from the high-mannose oligosaccharide (Glc)3(Man)9(GlcNAc)2, either from the free oligosaccharide or from the oligosaccharide attached to a protein via N-linkage. |
| | Kojibiose Preparation Products And Raw materials |
|