1,3-Dicyclohexylbarbituric acid manufacturers
|
| | 1,3-Dicyclohexylbarbituric acid Basic information |
| Product Name: | 1,3-Dicyclohexylbarbituric acid | | Synonyms: | 1,3-dicyclohexyl-barbituricaci;2,4,6(1H,3H,5H)-Pyrimidinetrione, 1,3-dicyclohexyl-;1,3-DicyclohexylbarbituricAcid>Daprodustat Impurity 11;1,3-dicyclohexyl-1,3-diazinane-2,4,6-trione;N,N'-Dicyclohexylbarbituric Acid;1,3-Dicyclohexyl-2,4,6(1H,3H,5H)-pyrimidinetrione;N1,N3-dicyclohexyl-N1,N3-bis(cyclohexylcarbamoyl)malonamide | | CAS: | 35824-91-0 | | MF: | C16H24N2O3 | | MW: | 292.37 | | EINECS: | | | Product Categories: | | | Mol File: | 35824-91-0.mol |  |
| | 1,3-Dicyclohexylbarbituric acid Chemical Properties |
| Melting point | 203 °C | | Boiling point | 413.8±28.0 °C(Predicted) | | density | 1.226±0.06 g/cm3(Predicted) | | pka | 6.09±0.40(Predicted) | | InChI | InChI=1S/C16H24N2O3/c19-14-11-15(20)18(13-9-5-2-6-10-13)16(21)17(14)12-7-3-1-4-8-12/h12-13H,1-11H2 | | InChIKey | PRZQJMWBZWAUKW-UHFFFAOYSA-N | | SMILES | C1(=O)N(C2CCCCC2)C(=O)CC(=O)N1C1CCCCC1 |
| | 1,3-Dicyclohexylbarbituric acid Usage And Synthesis |
| Uses | N,N''-Dicyclohexylbarbituric Acid is an intermediate in the synthesis of Daprodustat (D193368), which is a novel HIF (Hypoxia inducible factor)-prolyl hydroxylase inhibitor. |
| | 1,3-Dicyclohexylbarbituric acid Preparation Products And Raw materials |
|