|
|
| | N-(9-Fluorenylmethoxycarbonyl)-L-glutamic-15N acid Basic information |
| Product Name: | N-(9-Fluorenylmethoxycarbonyl)-L-glutamic-15N acid | | Synonyms: | L-Glutamic acid-15N, N-Fmoc;N-(9-FLUORENYLMETHOXYCARBONYL)-L-GLUTAMI C-15N ACID, 99 ATOM % 15N;fmoc-glu-oh-15n;L-Glutamic acid-15N, N-Fmoc, N-(9-Fluorenylmethoxycarbonyl)-L-glutamic-15N acid;Fmoc-Glu-OH-15N;N-(9-Fluorenylmethoxycarbonyl)-L-glutamic-15N acid | | CAS: | 287484-34-8 | | MF: | C20H19NO6 | | MW: | 370.38 | | EINECS: | | | Product Categories: | | | Mol File: | 287484-34-8.mol |  |
| | N-(9-Fluorenylmethoxycarbonyl)-L-glutamic-15N acid Chemical Properties |
| Melting point | 185-188 °C(lit.) | | storage temp. | 2-8°C(protect from light) | | Optical Rotation | [α]20/D -22°, c =1 in DMF | | Major Application | peptide synthesis | | InChI | 1S/C20H19NO6/c22-18(23)10-9-17(19(24)25)21-20(26)27-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H,21,26)(H,22,23)(H,24,25)/t17-/m0/s1/i21+1 | | InChIKey | QEPWHIXHJNNGLU-ZKBIZJTASA-N | | SMILES | OC(=O)CC[C@H]([15NH]C(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-(9-Fluorenylmethoxycarbonyl)-L-glutamic-15N acid Usage And Synthesis |
| | N-(9-Fluorenylmethoxycarbonyl)-L-glutamic-15N acid Preparation Products And Raw materials |
|