|
|
| | Diethyl Phenyl Phosphate Basic information |
| | Diethyl Phenyl Phosphate Chemical Properties |
| Boiling point | 130-135 °C(Press: 5 Torr) | | density | 1.1414 g/cm3 | | Fp | 128 °C | | storage temp. | Room Temperature (Recommended in a cool and dark place, <15°C) | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.15 | | InChI | InChI=1S/C10H15O4P/c1-3-12-15(11,13-4-2)14-10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 | | InChIKey | DHTQKXHLXVUBCF-UHFFFAOYSA-N | | SMILES | P(OC1=CC=CC=C1)(OCC)(OCC)=O |
| | Diethyl Phenyl Phosphate Usage And Synthesis |
| Definition | ChEBI: Diethyl phenyl phosphate is an aryl dialkyl phosphate. |
| | Diethyl Phenyl Phosphate Preparation Products And Raw materials |
|