| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4,6-Tris(3,4,5-trifluorophenyl)boroxin Basic information |
| Product Name: | 2,4,6-Tris(3,4,5-trifluorophenyl)boroxin | | Synonyms: | 3,4,5-TRIFLUOROPHENYLBORONIC ANHYDRIDE;TRIS(3,4,5-TRIFLUOROPHENYL)CYCLOBOROXANE;3,4,5-Trifluorophenylboronic Anhydride
Tris(3,4,5-trifluorophenyl)cycloboroxane;2,4,6-Tris(3,4,5-trifluorophenyl)-1,3,5,2,4,6-trioxatriborinane;Boroxin,tris(3,4,5-trifluorophenyl)- (9CI);Tris(3,4,5-trifluorophenyl)boroxin;Boroxin, 2,4,6-tris(3,4,5-trifluorophenyl)-;2,4,6-Tris(3,4,5-trifluorophenyl)boroxin | | CAS: | 223440-94-6 | | MF: | C18H6B3F9O3 | | MW: | 473.66 | | EINECS: | | | Product Categories: | B (Classes of Boron Compounds);Boronic Acids | | Mol File: | 223440-94-6.mol |  |
| | 2,4,6-Tris(3,4,5-trifluorophenyl)boroxin Chemical Properties |
| Boiling point | 375.9±52.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C18H6B3F9O3/c22-10-1-7(2-11(23)16(10)28)19-31-20(8-3-12(24)17(29)13(25)4-8)33-21(32-19)9-5-14(26)18(30)15(27)6-9/h1-6H | | InChIKey | SXINGRFBONUWIF-UHFFFAOYSA-N | | SMILES | O1B(C2=CC(F)=C(F)C(F)=C2)OB(C2=CC(F)=C(F)C(F)=C2)OB1C1=CC(F)=C(F)C(F)=C1 |
| | 2,4,6-Tris(3,4,5-trifluorophenyl)boroxin Usage And Synthesis |
| | 2,4,6-Tris(3,4,5-trifluorophenyl)boroxin Preparation Products And Raw materials |
|