| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
4-(2-Ethylhexyloxy)-2-hydroxybenzophenone manufacturers
- uv absorber 531L
-
-
2026-06-02
- CAS:2549-90-8
- Min. Order: 25KG
- Purity: 98%
- Supply Ability: 20 tons
|
| | 4-(2-Ethylhexyloxy)-2-hydroxybenzophenone Basic information |
| Product Name: | 4-(2-Ethylhexyloxy)-2-hydroxybenzophenone | | Synonyms: | 4-(2-Ethylhexyloxy)-2-hydroxybenzophenone;UF-5;UV Absorber 531L;Methanone, [4-[(2-ethylhexyl)oxy]-2-hydroxyphenyl]phenyl-;{4-[(2-ethylhexyl)oxy]-2-hydroxyphenyl}(phenyl)methanone;UV531L;4-(2-ethylhexoxy)-2-hydroxyphenyl]-phenylmethanone | | CAS: | 2549-90-8 | | MF: | C21H26O3 | | MW: | 326.43 | | EINECS: | 244-761-9 | | Product Categories: | | | Mol File: | 2549-90-8.mol |  |
| | 4-(2-Ethylhexyloxy)-2-hydroxybenzophenone Chemical Properties |
| Boiling point | 424.46°C (rough estimate) | | density | 1.0544 (rough estimate) | | refractive index | 1.6000 (estimate) | | pka | 7.57±0.35(Predicted) | | InChI | InChI=1S/C21H26O3/c1-3-5-9-16(4-2)15-24-18-12-13-19(20(22)14-18)21(23)17-10-7-6-8-11-17/h6-8,10-14,16,22H,3-5,9,15H2,1-2H3 | | InChIKey | SLXIKWJMGICOAO-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(OCC(CC)CCCC)C=C1O)(C1=CC=CC=C1)=O |
| | 4-(2-Ethylhexyloxy)-2-hydroxybenzophenone Usage And Synthesis |
| Preparation | Preparation by reaction of 1-chloro-2-ethylhexane with resbenzophenone in the presence of barium hydroxide and arsenic tribromide in dimethyl sulfoxide at 80° for 3 h (93%). |
| | 4-(2-Ethylhexyloxy)-2-hydroxybenzophenone Preparation Products And Raw materials |
|