| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Benzyloxyphenylboronic acid, pinacol ester Basic information |
| Product Name: | 4-Benzyloxyphenylboronic acid, pinacol ester | | Synonyms: | AKOS BRN-1149;4-BENZYLOXYBENZENEBORONIC ACID, PINACOL ESTER;2-(4-BENZYLOXYPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;4-Benzyloxybenzeneboronic acid, pinacol ester 98%;pinacol ester 98%;2-(4-Benzyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-Benzyloxyphenylboronic acid pinacol ester;4,4,5,5-tetramethyl-2-(4-phenylmethoxyphenyl)-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-(phenylmethoxy)phenyl]- | | CAS: | 754226-40-9 | | MF: | C19H23BO3 | | MW: | 310.2 | | EINECS: | | | Product Categories: | BoronicAcids;blocks | | Mol File: | 754226-40-9.mol |  |
| | 4-Benzyloxyphenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 81-85 °C(lit.) | | Boiling point | 428.5±28.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | 1S/C19H23BO3/c1-18(2)19(3,4)23-20(22-18)16-10-12-17(13-11-16)21-14-15-8-6-5-7-9-15/h5-13H,14H2,1-4H3 | | InChIKey | KMKOKPUXZWBMEI-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccc(OCc3ccccc3)cc2 |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HazardClass | IRRITANT, KEEP COLD | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 4-Benzyloxyphenylboronic acid, pinacol ester Usage And Synthesis |
| | 4-Benzyloxyphenylboronic acid, pinacol ester Preparation Products And Raw materials |
|