| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 2-(3-Benzyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Basic information |
| Product Name: | 2-(3-Benzyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | Synonyms: | 3-BENZYLOXYPHENYLBORONIC ACID, PINACOL ESTER;AKOS BRN-1150;2-(3-Benzyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 3-Benzyloxyphenylboronic acid pinacol ester;1,3,2-Dioxaborolane, 4,4,5,5-tetraMethyl-2-[3-(phenylMethoxy)phenyl]-;3-(Benzyloxy)phenylboronic acid pinacol ester 97%;2-(3-Benzyloxyphenyl)-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane
2-[3-(Benzyloxy)Phenyl]-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane;594369_Aldrich;4,4,5,5-Tetramethyl-2-[3-(phenylmethoxy)phenyl]-1,3,2-dioxaborolane | | CAS: | 765908-38-1 | | MF: | C19H23BO3 | | MW: | 310.2 | | EINECS: | | | Product Categories: | | | Mol File: | 765908-38-1.mol |  |
| | 2-(3-Benzyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical Properties |
| Melting point | 58-62 °C(lit.) | | Boiling point | 434.9±28.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | color | beige | | InChI | 1S/C19H23BO3/c1-18(2)19(3,4)23-20(22-18)16-11-8-12-17(13-16)21-14-15-9-6-5-7-10-15/h5-13H,14H2,1-4H3 | | InChIKey | CMBBWFXLHUITFS-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2cccc(OCc3ccccc3)c2 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 2-(3-Benzyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Usage And Synthesis |
| | 2-(3-Benzyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Preparation Products And Raw materials |
|