| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl 1-methyl-2-pyrroleacetate Basic information | | Uses |
| Product Name: | Methyl 1-methyl-2-pyrroleacetate | | Synonyms: | LABOTEST-BB LT00455212;METHYL 1-METHYLPYRROLE-2-ACETATE;METHYL,1-METHYL PYRROLEACETATE;METHYL 1-METHYL-2-PYRROLEACETATE;methyl 1-methylpyrrol-2-acetate;METHYL 1-METHYL-2-PYRROLEACETATE 96%;Methyl 1-methylpyrrol-2-ylacetate;1H-Pyrrole-2-acetic acid, 1-methyl-, methyl ester | | CAS: | 51856-79-2 | | MF: | C8H11NO2 | | MW: | 153.18 | | EINECS: | 257-478-0 | | Product Categories: | | | Mol File: | 51856-79-2.mol |  |
| | Methyl 1-methyl-2-pyrroleacetate Chemical Properties |
| Boiling point | 80-85 °C2 mm Hg(lit.) | | density | 1.064 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.501(lit.) | | Fp | 224 °F | | storage temp. | 2-8°C | | solubility | 8.3 g/L (20°C) | | pka | -3.42±0.70(Predicted) | | form | clear liquid | | color | Light yellow to Brown | | Water Solubility | 8.3 g/L (20 ºC) | | InChI | InChI=1S/C8H11NO2/c1-9-5-3-4-7(9)6-8(10)11-2/h3-5H,6H2,1-2H3 | | InChIKey | CGYVDYLHQYNGFC-UHFFFAOYSA-N | | SMILES | N1(C)C=CC=C1CC(OC)=O | | LogP | 0.886 (est) | | CAS DataBase Reference | 51856-79-2(CAS DataBase Reference) | | NIST Chemistry Reference | 1H-Pyrrole-2-acetic acid, 1-methyl-, methyl ester(51856-79-2) |
| | Methyl 1-methyl-2-pyrroleacetate Usage And Synthesis |
| Uses | 1-Methyl-2-pyrroleacetic acid methyl ester can be used as a pharmaceutical synthesis intermediate. | | Chemical Properties | CLEAR ORANGE TO SLIGHTLY BROWN LIQUID | | Synthesis | The intermediate 2-(1-methyl-1H-pyrrol-2-yl)-2-oxoacetic acid can be prepared from N-methylpyrrole and ethanedioyl chloride as the reaction raw materials, and 2-(1-methyl-1H-pyrrol-2-yl)acetic acid can be further reacted to prepare 2-(1-methyl-1H-pyrrol-2-yl)acetic acid, and finally esterification under the effect of p-toluenesulfonic acid to produce methyl 1-methyl-2-pyrroleacetate.
|
| | Methyl 1-methyl-2-pyrroleacetate Preparation Products And Raw materials |
|