| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
4-Hydroxy-3-methoxyphenylglycol hemipiperazinium salt manufacturers
|
| | 4-Hydroxy-3-methoxyphenylglycol hemipiperazinium salt Basic information |
| Product Name: | 4-Hydroxy-3-methoxyphenylglycol hemipiperazinium salt | | Synonyms: | MOPEG;DL-B-4-DIHYDROXY-3-METHOXYPHENETHYL ALCOHOL PIPERAZINE SALT;DL-BETA,4-DIHYDROXY-3-METHOXY-BETA-PHENETHYLALKOHOL HEMIPIPERAZIN;DL-BETA,4-DIHYDROXY-3-METHOXYPHENETHYL ALCOHOL PIPERAZINE SALT;DL-4-HYDROXY-3-METHOXYPHENYLGLYCOL PIPERAZINE SALT;BIS-(4-HYDROXY-3-METHOXYPHENYLGLYKOL) PIPERAZINSALZ;DL-4-hydroxy-3-methoxyphenylethyleneglycol--piperazine (2:1);4-HYDROXY-3-METHOXYPHENYLGLYCOL HEMIPIPERAZINE SALT | | CAS: | 67423-45-4 | | MF: | C22H34N2O8 | | MW: | 454.51 | | EINECS: | 266-689-7 | | Product Categories: | | | Mol File: | 67423-45-4.mol |  |
| | 4-Hydroxy-3-methoxyphenylglycol hemipiperazinium salt Chemical Properties |
| Melting point | 115-119 °C | | storage temp. | 2-8°C | | solubility | Methanol (Slightly) | | form | Solid | | color | Off-White | | BRN | 7360817 | | InChI | 1S/2C9H12O4.C4H10N2/c2*1-13-9-4-6(8(12)5-10)2-3-7(9)11;1-2-6-4-3-5-1/h2*2-4,8,10-12H,5H2,1H3;5-6H,1-4H2 | | InChIKey | KCECBJRHWSOTMR-UHFFFAOYSA-N | | SMILES | C1CNCCN1.COc2cc(ccc2O)C(O)CO.COc3cc(ccc3O)C(O)CO |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Hydroxy-3-methoxyphenylglycol hemipiperazinium salt Usage And Synthesis |
| Uses | 4-Hydroxy-3-methoxyphenylglycol Hemipiperazinium Salt is a cerebral norepinephrine metabolite. | | Biochem/physiol Actions | Cerebral norepinephrine metabolite. |
| | 4-Hydroxy-3-methoxyphenylglycol hemipiperazinium salt Preparation Products And Raw materials |
|