2-Chloro-N-ethylacetamide manufacturers
|
| | 2-Chloro-N-ethylacetamide Basic information |
| Product Name: | 2-Chloro-N-ethylacetamide | | Synonyms: | Acetamide, 2-chloro-N-ethyl-;TIMTEC-BB SBB008200;(N-CHLOROACETYL)ETHYL AMINE;N-ETHYL-2-CHLOROACETAMIDE;N-ETHYLCHLOROACETAMIDE;.alpha.-Chloro-N-ethylacetamide;2-chloro-N-ethyl-ethanamide;2-Chloro-N-ethylacetamide | | CAS: | 105-35-1 | | MF: | C4H8ClNO | | MW: | 121.57 | | EINECS: | 203-289-3 | | Product Categories: | | | Mol File: | 105-35-1.mol |  |
| | 2-Chloro-N-ethylacetamide Chemical Properties |
| Melting point | 129 °C(Solv: benzene (71-43-2)) | | Boiling point | 96 °C(Press: 13 Torr) | | density | 1.086±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 14.39±0.46(Predicted) | | InChI | InChI=1S/C4H8ClNO/c1-2-6-4(7)3-5/h2-3H2,1H3,(H,6,7) | | InChIKey | JUBORNFANZZVJL-UHFFFAOYSA-N | | SMILES | C(NCC)(=O)CCl |
| Hazard Codes | T | | Risk Statements | 36/37/38-25 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2924297099 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-Chloro-N-ethylacetamide Usage And Synthesis |
| Uses | 2-Chloro-N-ethylacetamide is an amide compound. It can be used to synthesise other organic heterocyclic compounds such as 2-(diphenylphosphoryl)-N-ethylacetamide and N-ethylcarbamoylmethyl 2-[3-(trifluoromethyl)anilino]nicotinic ester. |
| | 2-Chloro-N-ethylacetamide Preparation Products And Raw materials |
|