| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (DTBM)2PH Basic information |
| Product Name: | (DTBM)2PH | | Synonyms: | BIS(3,5-DI-TERT-BUTYL-4-METHOXYPHENYL)PHOSPHINE;(DTBM)2PH;Bis(3,5-di-t-butyl-4-Methoxyphenyl)phosphine, 97+%;bis(3,5-ditert-butyl-4-methoxyphenyl)phosphane;Phosphine, bis[3,5-bis(1,1-dimethylethyl)-4-methoxyphenyl]-;Bis(3,5-di-t-butyl-4-methoxyphenyl)phosphine;Bis[3,5-bis(1,1-dimethylethyl)-4-methoxyphenyl]phosphine;Bis(3,5-di-tert-butyl-4-methoxyphenyl)phosphine | | CAS: | 1173023-24-9 | | MF: | C30H47O2P | | MW: | 470.67 | | EINECS: | | | Product Categories: | Catalysis and Inorganic Chemistry;Phosphorus Compounds;Phosphorus Precursors | | Mol File: | Mol File |  |
| | (DTBM)2PH Chemical Properties |
| Melting point | 114-119 °C | | Boiling point | 526.1±50.0 °C(Predicted) | | form | solid | | InChI | 1S/C30H47O2P/c1-27(2,3)21-15-19(16-22(25(21)31-13)28(4,5)6)33-20-17-23(29(7,8)9)26(32-14)24(18-20)30(10,11)12/h15-18,33H,1-14H3 | | InChIKey | AZEBUSRDBBMQGF-UHFFFAOYSA-N | | SMILES | COc1c(cc(Pc2cc(c(OC)c(c2)C(C)(C)C)C(C)(C)C)cc1C(C)(C)C)C(C)(C)C |
| RIDADR | UN 3335 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (DTBM)2PH Usage And Synthesis |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | (DTBM)2PH Preparation Products And Raw materials |
|