| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Diphenhydramine-d3 Basic information |
| Product Name: | Diphenhydramine-d3 | | Synonyms: | Diphenhydramine-D3 solution;Diphenhydramine-D3 solution;Diphenhydramine-d3 | | CAS: | 170082-18-5 | | MF: | C17H18D3NO | | MW: | 258.37 | | EINECS: | 803-379-8 | | Product Categories: | | | Mol File: | Mol File |  |
| | Diphenhydramine-d3 Chemical Properties |
| Fp | 9℃ | | storage temp. | -20°C | | form | liquid | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H21NO/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3/i1D3 | | InChIKey | ZZVUWRFHKOJYTH-FIBGUPNXSA-N | | SMILES | CN(C([2H])([2H])[2H])CCOC(C1=CC=CC=C1)C2=CC=CC=C2 | | EPA Substance Registry System | Ethanamine, 2-(diphenylmethoxy)-N-methyl-N-(methyl-d3)- (170082-18-5) |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | Diphenhydramine-d3 Usage And Synthesis |
| Uses | pharmaceutical (small molecule) | | General Description | A stable-labeled internal standard for diphenhydramine testing or isotope dilution methods by GC/MS or LC/MS for clinical toxicology, urine drug testing, or forensic analysis. Diphenhydramine is an antihistamine sold over the counter under the trade name Benadryl. Dihydramine is also consumed recreationally as a euphoriant and a deliriant. |
| | Diphenhydramine-d3 Preparation Products And Raw materials |
|