| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Diphenhydramine-D3 solution
CAS:170082-18-5
Purity:100 mug/mL in methanol, ampule of 1 mL, certified reference Package:1ML Remarks:D-017-1ML
|
| Company Name: |
Shanghai YuZn Pharm. Technology Co.,Ltd.
|
| Tel: |
15921286451; 15921286451 |
| Email: |
2010681527@qq.com |
| Products Intro: |
Product Name:DIPHENHYDRAMINE-D3
CAS:170082-18-5
Purity:95% Package:100mg;500mg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Diphenhydramine-D3 solution
CAS:170082-18-5
|
|
| | DIPHENHYDRAMINE-D3 Basic information |
| Product Name: | DIPHENHYDRAMINE-D3 | | Synonyms: | DIPHENHYDRAMINE-D3;Diphenhydramine-D3 solution;Diphenhydramine-D3 solution | | CAS: | 170082-18-5 | | MF: | C17H18D3NO | | MW: | 258.37 | | EINECS: | 803-379-8 | | Product Categories: | | | Mol File: | Mol File |  |
| | DIPHENHYDRAMINE-D3 Chemical Properties |
| Fp | 9℃ | | storage temp. | -20°C | | form | liquid | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H21NO/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3/i1D3 | | InChIKey | ZZVUWRFHKOJYTH-FIBGUPNXSA-N | | SMILES | CN(C([2H])([2H])[2H])CCOC(C1=CC=CC=C1)C2=CC=CC=C2 | | EPA Substance Registry System | Ethanamine, 2-(diphenylmethoxy)-N-methyl-N-(methyl-d3)- (170082-18-5) |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | DIPHENHYDRAMINE-D3 Usage And Synthesis |
| Uses | pharmaceutical (small molecule) | | General Description | A stable-labeled internal standard for diphenhydramine testing or isotope dilution methods by GC/MS or LC/MS for clinical toxicology, urine drug testing, or forensic analysis. Diphenhydramine is an antihistamine sold over the counter under the trade name Benadryl. Dihydramine is also consumed recreationally as a euphoriant and a deliriant. |
| | DIPHENHYDRAMINE-D3 Preparation Products And Raw materials |
|