| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Potassium (4-carboxyphenyl)trifluoroborate Basic information |
| | Potassium (4-carboxyphenyl)trifluoroborate Chemical Properties |
| Melting point | >300 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C7H5BF3O2.K/c9-8(10,11)6-3-1-5(2-4-6)7(12)13;/h1-4H,(H,12,13);/q-1;+1 | | InChIKey | NMZCPMQLYMSRAD-UHFFFAOYSA-N | | SMILES | [K+].OC(=O)c1ccc(cc1)[B-](F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Potassium (4-carboxyphenyl)trifluoroborate Usage And Synthesis |
| | Potassium (4-carboxyphenyl)trifluoroborate Preparation Products And Raw materials |
|