| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:1,4-Phenylene diisocyanide
CAS:935-16-0
Purity:97% Package:1G
|
|
| | 1,4-DIISOCYANOBENZENE Basic information |
| Product Name: | 1,4-DIISOCYANOBENZENE | | Synonyms: | 4-ISOCYANOPHENYLISOCYANIDE;1,4-DIISOCYANOBENZENE;1,4-PHENYLENE DIISOCYANIDE;Benzene, 1,4-diisocyano- (9CI);(p-Phenylene)diisocyanide;Benzene,1,4-diisocyano-;p-Phenylenediisocyanide;1,4-Phenylene diisocyanide,1,4-Diisocyanobenzene | | CAS: | 935-16-0 | | MF: | C8H4N2 | | MW: | 128.13 | | EINECS: | | | Product Categories: | ISONITRITE;Building Blocks;Chemical Synthesis;Isocyanides;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 935-16-0.mol |  |
| | 1,4-DIISOCYANOBENZENE Chemical Properties |
| Melting point | 160 °C (dec.) (lit.) | | form | solid | | InChI | 1S/C8H4N2/c1-9-7-3-5-8(10-2)6-4-7/h3-6H | | InChIKey | IXACFSRTSHAQIX-UHFFFAOYSA-N | | SMILES | [C-]#[N+]c1ccc(cc1)[N+]#[C-] |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26 | | RIDADR | UN 3335 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,4-DIISOCYANOBENZENE Usage And Synthesis |
| | 1,4-DIISOCYANOBENZENE Preparation Products And Raw materials |
|