| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | 1-Benzyl-5-bromo-1H-indole Basic information |
| Product Name: | 1-Benzyl-5-bromo-1H-indole | | Synonyms: | 1-BENZYL-5-BROMOINDOLE;1H-Indole, 5-bromo-1-(phenylmethyl)-;Indole, 1-benzyl-5-bromo-;1-Benzyl-5-bromo-1H-indole;1-Benzyl-5-bromo-1H-indole | | CAS: | 10075-51-1 | | MF: | C15H12BrN | | MW: | 286.17 | | EINECS: | | | Product Categories: | | | Mol File: | 10075-51-1.mol |  |
| | 1-Benzyl-5-bromo-1H-indole Chemical Properties |
| Melting point | 93-95 °C | | Boiling point | 425.3±28.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C15H12BrN/c16-14-6-7-15-13(10-14)8-9-17(15)11-12-4-2-1-3-5-12/h1-10H,11H2 | | InChIKey | AQXJFUYUNHLBGU-UHFFFAOYSA-N | | SMILES | BrC1=CC=C2C(C=CN2CC3=CC=CC=C3)=C1 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2933.99.8290 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 1-Benzyl-5-bromo-1H-indole Usage And Synthesis |
| | 1-Benzyl-5-bromo-1H-indole Preparation Products And Raw materials |
|