|
|
| | 5,6,7,8-TETRAHYDRO-1,7-NAPHTHYRIDINE Basic information |
| Product Name: | 5,6,7,8-TETRAHYDRO-1,7-NAPHTHYRIDINE | | Synonyms: | 5,6,7,8-tetrahydro-1,7-naphthyridine dihydrochloride;5,6,7,8-TETRAHYDRO-1,7-NAPHTHYRIDINE 2HCL;5,6,7,8-Tetrahydro-1,7phthyridine dihydrochloride | | CAS: | 351038-62-5 | | MF: | C8H10N2 | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 351038-62-5.mol |  |
| | 5,6,7,8-TETRAHYDRO-1,7-NAPHTHYRIDINE Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | light gray solid | | InChI | InChI=1S/C8H10N2.2ClH/c1-2-7-3-5-9-6-8(7)10-4-1;;/h1-2,4,9H,3,5-6H2;2*1H | | InChIKey | ZRMBMVOGUOPEAZ-UHFFFAOYSA-N | | SMILES | C1C=C2CCNCC2=NC=1.Cl.Cl |
| | 5,6,7,8-TETRAHYDRO-1,7-NAPHTHYRIDINE Usage And Synthesis |
| Uses | 5,6,7,8-Tetrahydro-1,7-naphthyridine is used in the synthetic preparation of trisubstituted triazines via amination of cyanuric chloride with nitroaniline followed by substitution with amines exhibiting antimalarial activity. |
| | 5,6,7,8-TETRAHYDRO-1,7-NAPHTHYRIDINE Preparation Products And Raw materials |
|