3-Methyl-N-[(1R)-1-methyl-3-(4-methyl-1-piperidinyl)propyl]-N-methylbenzenesulfonamide hydrochloride manufacturers
- SB 258719
-
- $50.00
-
2026-07-27
- CAS:195199-95-2
- Purity: 99.73%
- Supply Ability: 10g
- SB 258719
-
- $50.00
-
2026-07-27
- CAS:195199-95-2
- Purity: 99.73%
- Supply Ability: 10g
|
| | 3-Methyl-N-[(1R)-1-methyl-3-(4-methyl-1-piperidinyl)propyl]-N-methylbenzenesulfonamide hydrochloride Basic information |
| Product Name: | 3-Methyl-N-[(1R)-1-methyl-3-(4-methyl-1-piperidinyl)propyl]-N-methylbenzenesulfonamide hydrochloride | | Synonyms: | SB 258719;SB 258719 HYDROCHLORIDE;Benzenesulfonamide, N,3-dimethyl-N-[(1R)-1-methyl-3-(4-methyl-1-piperidinyl)propyl]-;SB-258719 >=98% (HPLC);5-HT Receptor,5-hydroxytryptamine Receptor,agonism,SB258719,Inhibitor,inverse,hydrochloride,partial,SB 258719,SB-258719,apparent,selective,inhibit,Serotonin Receptor,affinity;SB 258719, 10 mM in DMSO;3-Methyl-N-[(1R)-1-methyl-3-(4-methyl-1-piperidinyl)propyl]-N-methylbenzenesulfonamide hydrochloride | | CAS: | 195199-95-2 | | MF: | C18H30N2O2S | | MW: | 338.51 | | EINECS: | | | Product Categories: | | | Mol File: | 195199-95-2.mol | ![3-Methyl-N-[(1R)-1-methyl-3-(4-methyl-1-piperidinyl)propyl]-N-methylbenzenesulfonamide hydrochloride Structure](CAS/GIF/195199-95-2.gif) |
| | 3-Methyl-N-[(1R)-1-methyl-3-(4-methyl-1-piperidinyl)propyl]-N-methylbenzenesulfonamide hydrochloride Chemical Properties |
| Boiling point | 463.6±55.0 °C(Predicted) | | density | 1.075±0.06 g/cm3(Predicted) | | storage temp. | Desiccate at RT | | solubility | DMSO: 250 mg/mL (738.53 mM) | | pka | 9.36±0.10(Predicted) | | form | Liquid | | color | Light yellow to yellow | | InChI | 1S/C18H30N2O2S/c1-15-8-11-20(12-9-15)13-10-17(3)19(4)23(21,22)18-7-5-6-16(2)14-18/h5-7,14-15,17H,8-13H2,1-4H3 | | InChIKey | AGVNHDNTFYHZNL-UHFFFAOYSA-N | | SMILES | CC1=CC=CC(S(N(C)[C@H](C)CCN2CCC(C)CC2)(=O)=O)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Methyl-N-[(1R)-1-methyl-3-(4-methyl-1-piperidinyl)propyl]-N-methylbenzenesulfonamide hydrochloride Usage And Synthesis |
| Uses | SB 258719 Hydrochloride is a useful intermediate. | | Biological Activity | Selective 5-HT 7 receptor antagonist that displays > 100-fold selectivity over a range of other receptors. Reverses the hypothermic effect of 5-CT in mice following i.p. administration. | | in vivo | SB 258719 (5-20 mg/kg; i.p.) significantly attenuates the 5-CT-induced hypothermia[2]. | Animal Model: | Male Swiss Webster mice (20-25 g)[2]. | | Dosage: | 5-20 mg/kg | | Administration: | I.p. | | Result: | Significantly attenuated the 5-CT-induced hypothermia.
|
| | IC 50 | 5-HT7 Receptor: 7.5 (pKi) |
| | 3-Methyl-N-[(1R)-1-methyl-3-(4-methyl-1-piperidinyl)propyl]-N-methylbenzenesulfonamide hydrochloride Preparation Products And Raw materials |
|